| MolName | N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-2-phenylacetamide |
| MolecularFormula | C19H21N3O2 |
| Smiles | O=C(Cc1ccccc1)N/N=C\c(cc1)ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H21N3O2/c23-19(14-16-4-2-1-3-5-16)21-20-15-17-6-8-18(9-7-17)22-10-12-24-13-11-22/h1-9,15H,10-14H2,(H,21,23) |
| InChIK | HOPOCLMIYMGNSR-UHFFFAOYSA-N |
| TotalMolweight | 323.395 |
| Molweight | 323.395 |
| MonoisotopicMass | 323.163377 |
| CLogP | 2.8687 |
| CLogS | -3.789 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 262.59 |
| Relative PSA | 0.18874 |
| PolarSurfaceArea | 53.93 |
| Druglikeness | 5.0864 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-2-phenylacetamide | 2 - N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-2-phenylacetamide