| MolName | 3-[(2-chlorophenyl)sulfamoyl]-N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]benzamide |
| MolecularFormula | C29H22N5O3ClS |
| Smiles | O=C(c1cccc(S(Nc(cccc2)c2Cl)(=O)=O)c1)N/N=C\c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C29H22ClN5O3S/c30-26-16-7-8-17-27(26)34-39(37,38)25-15-9-12-22(18-25)29(36)32-31-19-23-20-35(24-13-5-2-6-14-24)33-28(23)21-10-3-1-4-11-21/h1-20,34H,(H,32,36) |
| InChIK | HOXXGJKEAICMBF-UHFFFAOYSA-N |
| TotalMolweight | 556.045 |
| Molweight | 556.045 |
| MonoisotopicMass | 555.113187 |
| CLogP | 5.0257 |
| CLogS | -7.303 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 409.69 |
| Relative PSA | 0.22917 |
| PolarSurfaceArea | 113.83 |
| Druglikeness | 3.2885 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51282 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Sp3Atoms | 1 |
| Symmetricatoms | 5 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(2-chlorophenyl)sulfamoyl]-N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]benzamide | 2 - 3-[(2-chlorophenyl)sulfamoyl]-N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]benzamide