| MolName | 3-[(Z)-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| MolecularFormula | C19H13N4OFS2 |
| Smiles | O=C(CSC1=S)N1/N=C\c1cn(-c2ccccc2)nc1-c(cc1)ccc1F |
| InChI | InChI=1S/C19H13FN4OS2/c20-15-8-6-13(7-9-15)18-14(10-21-24-17(25)12-27-19(24)26)11-23(22-18)16-4-2-1-3-5-16/h1-11H,12H2 |
| InChIK | HPABADYCDBESNF-UHFFFAOYSA-N |
| TotalMolweight | 396.469 |
| Molweight | 396.469 |
| MonoisotopicMass | 396.051479 |
| CLogP | 1.9616 |
| CLogS | -5.092 |
| H Acceptors | 5 |
| TotalSurfaceArea | 290.36 |
| Relative PSA | 0.31488 |
| PolarSurfaceArea | 107.88 |
| Druglikeness | 3.0295 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.44444 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one | 2 - 3-[(Z)-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one