| MolName | (Z)-1-[2-[2-(4-bromophenoxy)ethoxy]-3,5-dichlorophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C17H13N4O2BrCl2 |
| Smiles | Clc(cc1/C=N\n2cnnc2)cc(Cl)c1OCCOc(cc1)ccc1Br |
| InChI | InChI=1S/C17H13BrCl2N4O2/c18-13-1-3-15(4-2-13)25-5-6-26-17-12(7-14(19)8-16(17)20)9-23-24-10-21-22-11-24/h1-4,7-11H,5-6H2 |
| InChIK | HPBUGLIGZZRIPQ-UHFFFAOYSA-N |
| TotalMolweight | 456.126 |
| Molweight | 456.126 |
| MonoisotopicMass | 453.959891 |
| CLogP | 4.5205 |
| CLogS | -7.884 |
| H Acceptors | 6 |
| TotalSurfaceArea | 301.25 |
| Relative PSA | 0.20023 |
| PolarSurfaceArea | 61.53 |
| Druglikeness | -5.5915 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[2-[2-(4-bromophenoxy)ethoxy]-3,5-dichlorophenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[2-[2-(4-bromophenoxy)ethoxy]-3,5-dichlorophenyl]-N-(1,2,4-triazol-4-yl)methanimine