| MolName | 2-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C20H19N7Cl2 |
| Smiles | Clc(cccc1/C=N\Nc2nc(N3CCCC3)nc(Nc3ccccc3)n2)c1Cl |
| InChI | InChI=1S/C20H19Cl2N7/c21-16-10-6-7-14(17(16)22)13-23-28-19-25-18(24-15-8-2-1-3-9-15)26-20(27-19)29-11-4-5-12-29/h1-3,6-10,13H,4-5,11-12H2,(H2,24,25,26,27,28) |
| InChIK | HPCYDGDIVIEKEE-UHFFFAOYSA-N |
| TotalMolweight | 428.326 |
| Molweight | 428.326 |
| MonoisotopicMass | 427.107897 |
| CLogP | 7.4959 |
| CLogS | -7.107 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 319.42 |
| Relative PSA | 0.22193 |
| PolarSurfaceArea | 78.33 |
| Druglikeness | 4.3452 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]-4-N-phenyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine