| MolName | N-[(Z)-(4-bromophenyl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| MolecularFormula | C13H16N3Br |
| Smiles | Brc1ccc(/C=N\NC2=NCCCCC2)cc1 |
| InChI | InChI=1S/C13H16BrN3/c14-12-7-5-11(6-8-12)10-16-17-13-4-2-1-3-9-15-13/h5-8,10H,1-4,9H2,(H,15,17) |
| InChIK | HPNKLKFLDJNHNJ-UHFFFAOYSA-N |
| TotalMolweight | 294.195 |
| Molweight | 294.195 |
| MonoisotopicMass | 293.052758 |
| CLogP | 3.2088 |
| CLogS | -4.367 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 206.38 |
| Relative PSA | 0.16707 |
| PolarSurfaceArea | 36.75 |
| Druglikeness | -3.2947 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.70588 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 2 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-bromophenyl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine | 2 - N-[(Z)-(4-bromophenyl)methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine