| MolName | N-[(Z)-[(E)-3-(4-bromophenyl)prop-2-enylidene]amino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| MolecularFormula | C20H24N7O2Br |
| Smiles | Brc1ccc(/C=C/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C20H24BrN7O2/c21-17-5-3-16(4-6-17)2-1-7-22-26-18-23-19(27-8-12-29-13-9-27)25-20(24-18)28-10-14-30-15-11-28/h1-7H,8-15H2,(H,23,24,25,26) |
| InChIK | HPZVQWGHTRJEQM-UHFFFAOYSA-N |
| TotalMolweight | 474.362 |
| Molweight | 474.362 |
| MonoisotopicMass | 473.117484 |
| CLogP | 4.344 |
| CLogS | -4.667 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 334.33 |
| Relative PSA | 0.2482 |
| PolarSurfaceArea | 88 |
| Druglikeness | 1.5195 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 10 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-(4-bromophenyl)prop-2-enylidene]amino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine | 2 - N-[(Z)-[(E)-3-(4-bromophenyl)prop-2-enylidene]amino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine