| MolName | [(Z)-[2-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]urea |
| MolecularFormula | C15H14N3O2Cl |
| Smiles | NC(N/N=C\c(cccc1)c1OCc1cccc(Cl)c1)=O |
| InChI | InChI=1S/C15H14ClN3O2/c16-13-6-3-4-11(8-13)10-21-14-7-2-1-5-12(14)9-18-19-15(17)20/h1-9H,10H2,(H3,17,19,20) |
| InChIK | HQCHGGNLKUPSNS-UHFFFAOYSA-N |
| TotalMolweight | 303.748 |
| Molweight | 303.748 |
| MonoisotopicMass | 303.077454 |
| CLogP | 3.0894 |
| CLogS | -4.891 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 234.69 |
| Relative PSA | 0.26111 |
| PolarSurfaceArea | 76.71 |
| Druglikeness | 3.9275 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61905 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-[2-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]urea | 2 - [(Z)-[2-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]urea