| MolName | N-[(Z)-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylideneamino]pyridine-4-carboxamide |
| MolecularFormula | C19H12N4O4 |
| Smiles | O=C(c1ccncc1)N/N=C\c1ccc(-c(cc2)cc(C(N3)=O)c2C3=O)o1 |
| InChI | InChI=1S/C19H12N4O4/c24-17(11-5-7-20-8-6-11)23-21-10-13-2-4-16(27-13)12-1-3-14-15(9-12)19(26)22-18(14)25/h1-10H,(H,23,24)(H,22,25,26) |
| InChIK | HQCOTABINBVICM-UHFFFAOYSA-N |
| TotalMolweight | 360.328 |
| Molweight | 360.328 |
| MonoisotopicMass | 360.085856 |
| CLogP | 2.2207 |
| CLogS | -4.757 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 268.66 |
| Relative PSA | 0.36712 |
| PolarSurfaceArea | 113.66 |
| Druglikeness | 7.3202 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylideneamino]pyridine-4-carboxamide | 2 - N-[(Z)-[5-(1,3-dioxoisoindol-5-yl)furan-2-yl]methylideneamino]pyridine-4-carboxamide