| MolName | [4-[(Z)-[[1-[(4-chlorophenyl)methyl]pyrazole-3-carbonyl]hydrazinylidene]methyl]phenyl] 3-chlorobenzoate |
| MolecularFormula | C25H18N4O3Cl2 |
| Smiles | O=C(c1nn(Cc(cc2)ccc2Cl)cc1)N/N=C\c(cc1)ccc1OC(c1cccc(Cl)c1)=O |
| InChI | InChI=1S/C25H18Cl2N4O3/c26-20-8-4-18(5-9-20)16-31-13-12-23(30-31)24(32)29-28-15-17-6-10-22(11-7-17)34-25(33)19-2-1-3-21(27)14-19/h1-15H,16H2,(H,29,32) |
| InChIK | HQIYOLHBRABEPY-UHFFFAOYSA-N |
| TotalMolweight | 493.349 |
| Molweight | 493.349 |
| MonoisotopicMass | 492.075595 |
| CLogP | 5.3179 |
| CLogS | -6.244 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 366.82 |
| Relative PSA | 0.20961 |
| PolarSurfaceArea | 85.58 |
| Druglikeness | 6.873 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67647 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[1-[(4-chlorophenyl)methyl]pyrazole-3-carbonyl]hydrazinylidene]methyl]phenyl] 3-chlorobenzoate | 2 - [4-[(Z)-[[1-[(4-chlorophenyl)methyl]pyrazole-3-carbonyl]hydrazinylidene]methyl]phenyl] 3-chlorobenzoate