| MolName | 3-[(Z)-(4-chloro-2-oxo-3-phenyl-1,3-thiazol-5-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-one |
| MolecularFormula | C22H13N4O2ClS2 |
| Smiles | O=C(N1c2ccccc2)SC(/C=N\N(C=Nc2c3c(-c4ccccc4)cs2)C3=O)=C1Cl |
| InChI | InChI=1S/C22H13ClN4O2S2/c23-19-17(31-22(29)27(19)15-9-5-2-6-10-15)11-25-26-13-24-20-18(21(26)28)16(12-30-20)14-7-3-1-4-8-14/h1-13H |
| InChIK | HQKDKRSCKBQVCX-UHFFFAOYSA-N |
| TotalMolweight | 464.956 |
| Molweight | 464.956 |
| MonoisotopicMass | 464.016843 |
| CLogP | 4.5526 |
| CLogS | -8.064 |
| H Acceptors | 6 |
| TotalSurfaceArea | 323.17 |
| Relative PSA | 0.29102 |
| PolarSurfaceArea | 118.88 |
| Druglikeness | 6.8356 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | polar activated DB; imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(4-chloro-2-oxo-3-phenyl-1,3-thiazol-5-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-(4-chloro-2-oxo-3-phenyl-1,3-thiazol-5-yl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-one