| MolName | N-[(Z)-(2-nitrophenyl)methylideneamino]-2,2-diphenylacetamide |
| MolecularFormula | C21H17N3O3 |
| Smiles | [O-][N+](c1c(/C=N\NC(C(c2ccccc2)c2ccccc2)=O)cccc1)=O |
| InChI | InChI=1S/C21H17N3O3/c25-21(23-22-15-18-13-7-8-14-19(18)24(26)27)20(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-15,20H,(H,23,25) |
| InChIK | HQYKDMMPBIEWFK-UHFFFAOYSA-N |
| TotalMolweight | 359.384 |
| Molweight | 359.384 |
| MonoisotopicMass | 359.126992 |
| CLogP | 3.8057 |
| CLogS | -5.295 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 282.92 |
| Relative PSA | 0.2348 |
| PolarSurfaceArea | 87.28 |
| Druglikeness | -0.0095932 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48148 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-nitrophenyl)methylideneamino]-2,2-diphenylacetamide | 2 - N-[(Z)-(2-nitrophenyl)methylideneamino]-2,2-diphenylacetamide