| MolName | N-[(Z)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| MolecularFormula | C30H22N4OS |
| Smiles | C(c1cccc2ccccc12)Oc1cccc(/C=N\Nc2c(c(-c3ccccc3)cs3)c3ncn2)c1 |
| InChI | InChI=1S/C30H22N4OS/c1-2-9-23(10-3-1)27-19-36-30-28(27)29(31-20-32-30)34-33-17-21-8-6-14-25(16-21)35-18-24-13-7-12-22-11-4-5-15-26(22)24/h1-17,19-20H,18H2,(H,31,32,34) |
| InChIK | HRGFRYDJOUNENJ-UHFFFAOYSA-N |
| TotalMolweight | 486.598 |
| Molweight | 486.598 |
| MonoisotopicMass | 486.151431 |
| CLogP | 8.8662 |
| CLogS | -9.669 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 375.18 |
| Relative PSA | 0.20062 |
| PolarSurfaceArea | 87.64 |
| Druglikeness | 2.3498 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 31 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine | 2 - N-[(Z)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine