| MolName | N-[(Z)-1-(4-nitrophenyl)-3-[(2Z)-2-[(E)-3-(2-nitrophenyl)prop-2-enylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| MolecularFormula | C25H19N5O6 |
| Smiles | [O-][N+](c1ccc(/C=C(/C(N/N=C\C=C\c(cccc2)c2[N+]([O-])=O)=O)\NC(c2ccccc2)=O)cc1)=O |
| InChI | InChI=1S/C25H19N5O6/c31-24(20-8-2-1-3-9-20)27-22(17-18-12-14-21(15-13-18)29(33)34)25(32)28-26-16-6-10-19-7-4-5-11-23(19)30(35)36/h1-17H,(H,27,31)(H,28,32) |
| InChIK | HRIIGAYNVHHCKT-UHFFFAOYSA-N |
| TotalMolweight | 485.455 |
| Molweight | 485.455 |
| MonoisotopicMass | 485.133535 |
| CLogP | 2.9934 |
| CLogS | -6.678 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 374.51 |
| Relative PSA | 0.32402 |
| PolarSurfaceArea | 162.2 |
| Druglikeness | 1.307 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1-(4-nitrophenyl)-3-[(2Z)-2-[(E)-3-(2-nitrophenyl)prop-2-enylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide | 2 - N-[(Z)-1-(4-nitrophenyl)-3-[(2Z)-2-[(E)-3-(2-nitrophenyl)prop-2-enylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide