| MolName | N-[(Z)-[1-[2-(4-fluoroanilino)-2-oxoethyl]indol-3-yl]methylideneamino]-3-iodobenzamide |
| MolecularFormula | C24H18N4O2FI |
| Smiles | O=C(Cn1c(cccc2)c2c(/C=N\NC(c2cccc(I)c2)=O)c1)Nc(cc1)ccc1F |
| InChI | InChI=1S/C24H18FIN4O2/c25-18-8-10-20(11-9-18)28-23(31)15-30-14-17(21-6-1-2-7-22(21)30)13-27-29-24(32)16-4-3-5-19(26)12-16/h1-14H,15H2,(H,28,31)(H,29,32) |
| InChIK | HRKVZMZFLIKCSD-UHFFFAOYSA-N |
| TotalMolweight | 540.331 |
| Molweight | 540.331 |
| MonoisotopicMass | 540.045852 |
| CLogP | 4.5538 |
| CLogS | -6.218 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 346.15 |
| Relative PSA | 0.19466 |
| PolarSurfaceArea | 75.49 |
| Druglikeness | 5.7932 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59375 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[2-(4-fluoroanilino)-2-oxoethyl]indol-3-yl]methylideneamino]-3-iodobenzamide | 2 - N-[(Z)-[1-[2-(4-fluoroanilino)-2-oxoethyl]indol-3-yl]methylideneamino]-3-iodobenzamide