| MolName | (Z)-N-(3-benzylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)-1-(4-bromophenyl)methanimine |
| MolecularFormula | C21H16N5BrS |
| Smiles | Brc1ccc(/C=N\n2c(SCc3ccccc3)nnc2-c2ccncc2)cc1 |
| InChI | InChI=1S/C21H16BrN5S/c22-19-8-6-16(7-9-19)14-24-27-20(18-10-12-23-13-11-18)25-26-21(27)28-15-17-4-2-1-3-5-17/h1-14H,15H2 |
| InChIK | HRPSPKKVLNQKGD-UHFFFAOYSA-N |
| TotalMolweight | 450.363 |
| Molweight | 450.363 |
| MonoisotopicMass | 449.030976 |
| CLogP | 4.7991 |
| CLogS | -8.692 |
| H Acceptors | 5 |
| TotalSurfaceArea | 312.66 |
| Relative PSA | 0.21998 |
| PolarSurfaceArea | 81.26 |
| Druglikeness | 1.9768 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-(3-benzylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)-1-(4-bromophenyl)methanimine | 2 - (Z)-N-(3-benzylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)-1-(4-bromophenyl)methanimine