| MolName | 4-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C15H8N5O2Cl3S |
| Smiles | [O-][N+](c(cc1)cc(/C=N\N(C(c(ccc(Cl)c2)c2Cl)=NN2)C2=S)c1Cl)=O |
| InChI | InChI=1S/C15H8Cl3N5O2S/c16-9-1-3-11(13(18)6-9)14-20-21-15(26)22(14)19-7-8-5-10(23(24)25)2-4-12(8)17/h1-7H,(H,21,26) |
| InChIK | HRXJZSXOXAXJRF-UHFFFAOYSA-N |
| TotalMolweight | 428.687 |
| Molweight | 428.687 |
| MonoisotopicMass | 426.946426 |
| CLogP | 4.1914 |
| CLogS | -7.119 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 291.65 |
| Relative PSA | 0.3307 |
| PolarSurfaceArea | 117.9 |
| Druglikeness | -1.5955 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-3-(2,4-dichlorophenyl)-1H-1,2,4-triazole-5-thione