| MolName | 2-naphthalen-2-yloxy-N-[(Z)-[4-[(Z)-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl]methylideneamino]acetamide |
| MolecularFormula | C32H26N4O4 |
| Smiles | O=C(COc1cc2ccccc2cc1)N/N=C\c1ccc(/C=N\NC(COc2cc3ccccc3cc2)=O)cc1 |
| InChI | InChI=1S/C32H26N4O4/c37-31(21-39-29-15-13-25-5-1-3-7-27(25)17-29)35-33-19-23-9-11-24(12-10-23)20-34-36-32(38)22-40-30-16-14-26-6-2-4-8-28(26)18-30/h1-20H,21-22H2,(H,35,37)(H,36,38) |
| InChIK | HSOJHLCVUNOMBD-UHFFFAOYSA-N |
| TotalMolweight | 530.582 |
| Molweight | 530.582 |
| MonoisotopicMass | 530.195406 |
| CLogP | 6.2822 |
| CLogS | -8.598 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 417.44 |
| Relative PSA | 0.22044 |
| PolarSurfaceArea | 101.38 |
| Druglikeness | 4.1966 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 4 |
| Symmetricatoms | 21 |
| StereoCon |
Click to Load Molecule:
1 - 2-naphthalen-2-yloxy-N-[(Z)-[4-[(Z)-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl]methylideneamino]acetamide | 2 - 2-naphthalen-2-yloxy-N-[(Z)-[4-[(Z)-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl]methylideneamino]acetamide