| MolName | N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-5-(3-nitrophenyl)furan-2-carboxamide |
| MolecularFormula | C27H20N4O4 |
| Smiles | [O-][N+](c1cc(-c2ccc(C(N/N=C\c3cn(Cc4ccccc4)c4c3cccc4)=O)o2)ccc1)=O |
| InChI | InChI=1S/C27H20N4O4/c32-27(26-14-13-25(35-26)20-9-6-10-22(15-20)31(33)34)29-28-16-21-18-30(17-19-7-2-1-3-8-19)24-12-5-4-11-23(21)24/h1-16,18H,17H2,(H,29,32) |
| InChIK | HSULVBHAOMRRDZ-UHFFFAOYSA-N |
| TotalMolweight | 464.48 |
| Molweight | 464.48 |
| MonoisotopicMass | 464.148456 |
| CLogP | 4.7486 |
| CLogS | -6.619 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 357.43 |
| Relative PSA | 0.24455 |
| PolarSurfaceArea | 105.35 |
| Druglikeness | 2.0119 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-5-(3-nitrophenyl)furan-2-carboxamide | 2 - N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-5-(3-nitrophenyl)furan-2-carboxamide