| MolName | N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]naphthalene-2-carboxamide |
| MolecularFormula | C22H14N2O2Cl2 |
| Smiles | O=C(c1cc2ccccc2cc1)N/N=C\c1ccc(-c(cc(cc2)Cl)c2Cl)o1 |
| InChI | InChI=1S/C22H14Cl2N2O2/c23-17-7-9-20(24)19(12-17)21-10-8-18(28-21)13-25-26-22(27)16-6-5-14-3-1-2-4-15(14)11-16/h1-13H,(H,26,27) |
| InChIK | HTUHHRDYFBCOHW-UHFFFAOYSA-N |
| TotalMolweight | 409.271 |
| Molweight | 409.271 |
| MonoisotopicMass | 408.043232 |
| CLogP | 6.5469 |
| CLogS | -8.259 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 301.88 |
| Relative PSA | 0.16603 |
| PolarSurfaceArea | 54.6 |
| Druglikeness | 6.4937 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]naphthalene-2-carboxamide | 2 - N-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]naphthalene-2-carboxamide