| MolName | N-[(Z)-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
| MolecularFormula | C24H17N4O3F |
| Smiles | O=C(c(cc1)cc2c1OCO2)N/N=C\c1cn(-c2ccccc2)nc1-c(cc1)ccc1F |
| InChI | InChI=1S/C24H17FN4O3/c25-19-9-6-16(7-10-19)23-18(14-29(28-23)20-4-2-1-3-5-20)13-26-27-24(30)17-8-11-21-22(12-17)32-15-31-21/h1-14H,15H2,(H,27,30) |
| InChIK | HTWSFNKBFGMYRT-UHFFFAOYSA-N |
| TotalMolweight | 428.422 |
| Molweight | 428.422 |
| MonoisotopicMass | 428.128469 |
| CLogP | 4.3328 |
| CLogS | -6.259 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 321.08 |
| Relative PSA | 0.23 |
| PolarSurfaceArea | 77.74 |
| Druglikeness | 4.3967 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1,3-benzodioxole-5-carboxamide | 2 - N-[(Z)-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1,3-benzodioxole-5-carboxamide