| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-phenylethanesulfonamide |
| MolecularFormula | C15H14N2O2Cl2S |
| Smiles | O=S(CCc1ccccc1)(N/N=C\c(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C15H14Cl2N2O2S/c16-14-7-6-13(15(17)10-14)11-18-19-22(20,21)9-8-12-4-2-1-3-5-12/h1-7,10-11,19H,8-9H2 |
| InChIK | HUACPONMZGQXGC-UHFFFAOYSA-N |
| TotalMolweight | 357.26 |
| Molweight | 357.26 |
| MonoisotopicMass | 356.015302 |
| CLogP | 4.1776 |
| CLogS | -4.509 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 256.18 |
| Relative PSA | 0.20123 |
| PolarSurfaceArea | 66.91 |
| Druglikeness | 0.20835 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-phenylethanesulfonamide | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-2-phenylethanesulfonamide