| MolName | N-(4-chlorophenyl)-5-nitro-2-[(2E)-2-[(3-phenylmethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide |
| MolecularFormula | C26H21N4O5ClS |
| Smiles | [O-][N+](c(cc1)cc(S(Nc(cc2)ccc2Cl)(=O)=O)c1N/N=C/c1cc(OCc2ccccc2)ccc1)=O |
| InChI | InChI=1S/C26H21ClN4O5S/c27-21-9-11-22(12-10-21)30-37(34,35)26-16-23(31(32)33)13-14-25(26)29-28-17-20-7-4-8-24(15-20)36-18-19-5-2-1-3-6-19/h1-17,29-30H,18H2 |
| InChIK | HUEYCLVPTGRCLO-UHFFFAOYSA-N |
| TotalMolweight | 536.995 |
| Molweight | 536.995 |
| MonoisotopicMass | 536.092118 |
| CLogP | 6.1725 |
| CLogS | -7.019 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 391.65 |
| Relative PSA | 0.26409 |
| PolarSurfaceArea | 133.99 |
| Druglikeness | -7.534 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.56757 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 5 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(4-chlorophenyl)-5-nitro-2-[(2E)-2-[(3-phenylmethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide | 2 - N-(4-chlorophenyl)-5-nitro-2-[(2E)-2-[(3-phenylmethoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide