| MolName | N-[(E)-3-oxo-3-[(2Z)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| MolecularFormula | C23H19N3O2S |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C\c1cccs1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C23H19N3O2S/c27-22(19-12-5-2-6-13-19)25-21(17-20-14-8-16-29-20)23(28)26-24-15-7-11-18-9-3-1-4-10-18/h1-17H,(H,25,27)(H,26,28) |
| InChIK | HUJFZTFDQCBSKL-UHFFFAOYSA-N |
| TotalMolweight | 401.489 |
| Molweight | 401.489 |
| MonoisotopicMass | 401.119797 |
| CLogP | 4.7032 |
| CLogS | -5.768 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 323.11 |
| Relative PSA | 0.25029 |
| PolarSurfaceArea | 98.8 |
| Druglikeness | 7.5888 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58621 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-3-oxo-3-[(2Z)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]-1-thiophen-2-ylprop-1-en-2-yl]benzamide | 2 - N-[(E)-3-oxo-3-[(2Z)-2-[(E)-3-phenylprop-2-enylidene]hydrazinyl]-1-thiophen-2-ylprop-1-en-2-yl]benzamide