| MolName | N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]benzenesulfonamide |
| MolecularFormula | C14H12N2O3F2S |
| Smiles | O=S(c1ccccc1)(N/N=C\c(cccc1)c1OC(F)F)=O |
| InChI | InChI=1S/C14H12F2N2O3S/c15-14(16)21-13-9-5-4-6-11(13)10-17-18-22(19,20)12-7-2-1-3-8-12/h1-10,14,18H |
| InChIK | HUTTUQXLTHTBIN-UHFFFAOYSA-N |
| TotalMolweight | 326.322 |
| Molweight | 326.322 |
| MonoisotopicMass | 326.053669 |
| CLogP | 2.4465 |
| CLogS | -2.538 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 233.02 |
| Relative PSA | 0.26414 |
| PolarSurfaceArea | 76.14 |
| Druglikeness | -7.3937 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]benzenesulfonamide | 2 - N-[(Z)-[2-(difluoromethoxy)phenyl]methylideneamino]benzenesulfonamide