| MolName | [4-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| MolecularFormula | C26H20N3O3Cl |
| Smiles | O=C(CNc1cc2ccccc2cc1)N/N=C\c(cc1)ccc1OC(c(cccc1)c1Cl)=O |
| InChI | InChI=1S/C26H20ClN3O3/c27-24-8-4-3-7-23(24)26(32)33-22-13-9-18(10-14-22)16-29-30-25(31)17-28-21-12-11-19-5-1-2-6-20(19)15-21/h1-16,28H,17H2,(H,30,31) |
| InChIK | HUVFTACEWRJBGV-UHFFFAOYSA-N |
| TotalMolweight | 457.916 |
| Molweight | 457.916 |
| MonoisotopicMass | 457.119319 |
| CLogP | 5.7244 |
| CLogS | -7.355 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 349.74 |
| Relative PSA | 0.20161 |
| PolarSurfaceArea | 79.79 |
| Druglikeness | 4.7162 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate | 2 - [4-[(Z)-[[2-(naphthalen-2-ylamino)acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate