| MolName | N'-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]oxamide |
| MolecularFormula | C16H15N3O3 |
| Smiles | NC(C(N/N=C\c1cc(OCc2ccccc2)ccc1)=O)=O |
| InChI | InChI=1S/C16H15N3O3/c17-15(20)16(21)19-18-10-13-7-4-8-14(9-13)22-11-12-5-2-1-3-6-12/h1-10H,11H2,(H2,17,20)(H,19,21) |
| InChIK | HVFCCAFNTCKGQG-UHFFFAOYSA-N |
| TotalMolweight | 297.313 |
| Molweight | 297.313 |
| MonoisotopicMass | 297.111342 |
| CLogP | 1.4318 |
| CLogS | -3.443 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 237.02 |
| Relative PSA | 0.31356 |
| PolarSurfaceArea | 93.78 |
| Druglikeness | 1.9336 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]oxamide | 2 - N'-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]oxamide