| MolName | N-[(Z)-naphthalen-2-ylmethylideneamino]-2,2-diphenylacetamide |
| MolecularFormula | C25H20N2O |
| Smiles | O=C(C(c1ccccc1)c1ccccc1)N/N=C\c1cc2ccccc2cc1 |
| InChI | InChI=1S/C25H20N2O/c28-25(24(21-10-3-1-4-11-21)22-12-5-2-6-13-22)27-26-18-19-15-16-20-9-7-8-14-23(20)17-19/h1-18,24H,(H,27,28) |
| InChIK | HVHGARBHLVNZSF-UHFFFAOYSA-N |
| TotalMolweight | 364.447 |
| Molweight | 364.447 |
| MonoisotopicMass | 364.157563 |
| CLogP | 5.9217 |
| CLogS | -6.441 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 293.85 |
| Relative PSA | 0.12255 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 5.187 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 1 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-naphthalen-2-ylmethylideneamino]-2,2-diphenylacetamide | 2 - N-[(Z)-naphthalen-2-ylmethylideneamino]-2,2-diphenylacetamide