| MolName | N-(4-phenylmethoxyphenyl)-N'-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]oxamide |
| MolecularFormula | C29H25N3O4 |
| Smiles | O=C(C(N/N=C\c(cccc1)c1OCc1ccccc1)=O)Nc(cc1)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C29H25N3O4/c33-28(31-25-15-17-26(18-16-25)35-20-22-9-3-1-4-10-22)29(34)32-30-19-24-13-7-8-14-27(24)36-21-23-11-5-2-6-12-23/h1-19H,20-21H2,(H,31,33)(H,32,34) |
| InChIK | HVKHXIDPARSDRE-UHFFFAOYSA-N |
| TotalMolweight | 479.535 |
| Molweight | 479.535 |
| MonoisotopicMass | 479.184507 |
| CLogP | 4.8401 |
| CLogS | -6.207 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 383.24 |
| Relative PSA | 0.21008 |
| PolarSurfaceArea | 89.02 |
| Druglikeness | 3.3836 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(4-phenylmethoxyphenyl)-N'-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]oxamide | 2 - N-(4-phenylmethoxyphenyl)-N'-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]oxamide