| MolName | 4,6-bis(azepan-1-yl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-1,3,5-triazin-2-amine |
| MolecularFormula | C22H29N7Cl2 |
| Smiles | Clc1cc(Cl)c(/C=N\Nc2nc(N3CCCCCC3)nc(N3CCCCCC3)n2)cc1 |
| InChI | InChI=1S/C22H29Cl2N7/c23-18-10-9-17(19(24)15-18)16-25-29-20-26-21(30-11-5-1-2-6-12-30)28-22(27-20)31-13-7-3-4-8-14-31/h9-10,15-16H,1-8,11-14H2,(H,26,27,28,29) |
| InChIK | HVPPRERXBHUSJN-UHFFFAOYSA-N |
| TotalMolweight | 462.427 |
| Molweight | 462.427 |
| MonoisotopicMass | 461.186147 |
| CLogP | 7.8245 |
| CLogS | -7.331 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 355.08 |
| Relative PSA | 0.17737 |
| PolarSurfaceArea | 69.54 |
| Druglikeness | 0.29671 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 12 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4,6-bis(azepan-1-yl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-1,3,5-triazin-2-amine | 2 - 4,6-bis(azepan-1-yl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-1,3,5-triazin-2-amine