| MolName | [3-[(Z)-[[2-(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| MolecularFormula | C23H16N2O6BrCl |
| Smiles | O=C(COc(ccc(Cl)c1)c1Br)N/N=C\c1cc(OC(c(cc2)cc3c2OCO3)=O)ccc1 |
| InChI | InChI=1S/C23H16BrClN2O6/c24-18-10-16(25)5-7-19(18)30-12-22(28)27-26-11-14-2-1-3-17(8-14)33-23(29)15-4-6-20-21(9-15)32-13-31-20/h1-11H,12-13H2,(H,27,28) |
| InChIK | HVRLDPOSAAGHDN-UHFFFAOYSA-N |
| TotalMolweight | 531.745 |
| Molweight | 531.745 |
| MonoisotopicMass | 529.988026 |
| CLogP | 5.6496 |
| CLogS | -7.252 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 352.57 |
| Relative PSA | 0.25257 |
| PolarSurfaceArea | 95.45 |
| Druglikeness | 2.2014 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - [3-[(Z)-[[2-(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate | 2 - [3-[(Z)-[[2-(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate