| MolName | 2-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]benzoate |
| MolecularFormula | C16H12N2O4Cl |
| Smiles | [O-]C(c1c(/C=N\NC(COc(cc2)ccc2Cl)=O)cccc1)=O |
| InChI | InChI=1S/C16H13ClN2O4/c17-12-5-7-13(8-6-12)23-10-15(20)19-18-9-11-3-1-2-4-14(11)16(21)22/h1-9H,10H2,(H,19,20)(H,21,22)/p-1 |
| InChIK | HWCRWUFDJDUSDO-UHFFFAOYSA-M |
| TotalMolweight | 331.734 |
| Molweight | 331.734 |
| MonoisotopicMass | 331.04856 |
| CLogP | 0.7916 |
| CLogS | -4.25 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 251.45 |
| Relative PSA | 0.29163 |
| PolarSurfaceArea | 90.82 |
| Druglikeness | 4.2862 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]benzoate | 2 - 2-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]benzoate