2-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]benzoic acid
Formula:C16H13N2O4Cl
Mutagenic:none
Tumorigenic:none
Reproductive Effective:high
2-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]benzoic acid is a drug-like molecule.
| MolName | 2-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]benzoic acid |
| MolecularFormula | C16H13N2O4Cl |
| Smiles | OC(c1c(/C=N\NC(COc(cc2)ccc2Cl)=O)cccc1)=O |
| InChI | InChI=1S/C16H13ClN2O4/c17-12-5-7-13(8-6-12)23-10-15(20)19-18-9-11-3-1-2-4-14(11)16(21)22/h1-9H,10H2,(H,19,20)(H,21,22) |
| InChIK | HWCRWUFDJDUSDO-UHFFFAOYSA-N |
| TotalMolweight | 332.742 |
| Molweight | 332.742 |
| MonoisotopicMass | 332.056385 |
| CLogP | 2.8676 |
| CLogS | -4.25 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 250.27 |
| Relative PSA | 0.28829 |
| PolarSurfaceArea | 87.99 |
| Druglikeness | 4.0659 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]benzoic acid | 2 - 2-[(Z)-[[2-(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]benzoic acid
Spacefill |
Wire |
Ball & Stick |
Iso-vdw |
Opaque |
Dot Surface |
Mep |
Translucent |
Spin |
Label On |
Off