| MolName | N-[(Z)-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| MolecularFormula | C27H19N2O3Br |
| Smiles | O=C(c1cc(cccc2)c2o1)N/N=C\c(cc1)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C27H19BrN2O3/c28-23-14-18(16-29-30-27(31)26-15-20-7-2-4-11-24(20)33-26)12-13-25(23)32-17-21-9-5-8-19-6-1-3-10-22(19)21/h1-16H,17H2,(H,30,31) |
| InChIK | HWLZFYBUPOHHNI-UHFFFAOYSA-N |
| TotalMolweight | 499.363 |
| Molweight | 499.363 |
| MonoisotopicMass | 498.057904 |
| CLogP | 6.9749 |
| CLogS | -8.685 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 348.03 |
| Relative PSA | 0.17274 |
| PolarSurfaceArea | 63.83 |
| Druglikeness | 2.6867 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60606 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-benzofuran-2-carboxamide | 2 - N-[(Z)-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-benzofuran-2-carboxamide