| MolName | N-[2-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| MolecularFormula | C18H17N3O5 |
| Smiles | Oc1cccc(/C=N\NC(CNC(c(cc2)cc3c2OCCO3)=O)=O)c1 |
| InChI | InChI=1S/C18H17N3O5/c22-14-3-1-2-12(8-14)10-20-21-17(23)11-19-18(24)13-4-5-15-16(9-13)26-7-6-25-15/h1-5,8-10,22H,6-7,11H2,(H,19,24)(H,21,23) |
| InChIK | HXFTVDCKJWBHJV-UHFFFAOYSA-N |
| TotalMolweight | 355.349 |
| Molweight | 355.349 |
| MonoisotopicMass | 355.116822 |
| CLogP | 1.9184 |
| CLogS | -3.374 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 270.33 |
| Relative PSA | 0.34628 |
| PolarSurfaceArea | 109.25 |
| Druglikeness | -1.8562 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide | 2 - N-[2-[(2Z)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide