| MolName | 3-[(Z)-(1-benzylindol-3-yl)methylideneamino]-8-bromo-1,5-dihydropyrimido[5,4-b]indole-2,4-dione |
| MolecularFormula | C26H18N5O2Br |
| Smiles | O=C(c([nH]c(cc1)c2cc1Br)c2NC1=O)N1/N=C\c1cn(Cc2ccccc2)c2c1cccc2 |
| InChI | InChI=1S/C26H18BrN5O2/c27-18-10-11-21-20(12-18)23-24(29-21)25(33)32(26(34)30-23)28-13-17-15-31(14-16-6-2-1-3-7-16)22-9-5-4-8-19(17)22/h1-13,15,29H,14H2,(H,30,34) |
| InChIK | HXGQREQWHLJTNR-UHFFFAOYSA-N |
| TotalMolweight | 512.366 |
| Molweight | 512.366 |
| MonoisotopicMass | 511.064386 |
| CLogP | 4.7713 |
| CLogS | -6.459 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 341.66 |
| Relative PSA | 0.21501 |
| PolarSurfaceArea | 82.49 |
| Druglikeness | 4.7474 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(1-benzylindol-3-yl)methylideneamino]-8-bromo-1,5-dihydropyrimido[5,4-b]indole-2,4-dione | 2 - 3-[(Z)-(1-benzylindol-3-yl)methylideneamino]-8-bromo-1,5-dihydropyrimido[5,4-b]indole-2,4-dione