| MolName | [2,4-dibromo-6-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate |
| MolecularFormula | C22H13N2O4Br3Cl2 |
| Smiles | O=C(COc(ccc(Cl)c1)c1Cl)N/N=C\c1cc(Br)cc(Br)c1OC(c(cccc1)c1Br)=O |
| InChI | InChI=1S/C22H13Br3Cl2N2O4/c23-13-7-12(10-28-29-20(30)11-32-19-6-5-14(26)9-18(19)27)21(17(25)8-13)33-22(31)15-3-1-2-4-16(15)24/h1-10H,11H2,(H,29,30) |
| InChIK | HXTZJWADQYMSGX-UHFFFAOYSA-N |
| TotalMolweight | 679.973 |
| Molweight | 679.973 |
| MonoisotopicMass | 675.780245 |
| CLogP | 7.5946 |
| CLogS | -8.945 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 384.99 |
| Relative PSA | 0.17936 |
| PolarSurfaceArea | 76.99 |
| Druglikeness | 2.2306 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - [2,4-dibromo-6-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate | 2 - [2,4-dibromo-6-[(Z)-[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate