| MolName | N-[(Z)-(3-nitrophenyl)methylideneamino]-2-[[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-nitrosoamino]acetamide |
| MolecularFormula | C18H16N8O7 |
| Smiles | [O-][N+](c1cccc(/C=N\NC(CN(CC(N/N=C\c2cccc([N+]([O-])=O)c2)=O)N=O)=O)c1)=O |
| InChI | InChI=1S/C18H16N8O7/c27-17(21-19-9-13-3-1-5-15(7-13)25(30)31)11-24(23-29)12-18(28)22-20-10-14-4-2-6-16(8-14)26(32)33/h1-10H,11-12H2,(H,21,27)(H,22,28) |
| InChIK | HXXAQBDEBJBHDG-UHFFFAOYSA-N |
| TotalMolweight | 456.374 |
| Molweight | 456.374 |
| MonoisotopicMass | 456.114197 |
| CLogP | 0.393 |
| CLogS | -4.456 |
| H Acceptors | 15 |
| H Donors | 2 |
| TotalSurfaceArea | 343.92 |
| Relative PSA | 0.46802 |
| PolarSurfaceArea | 207.23 |
| Druglikeness | -0.15324 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; nitroso; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 10 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 15 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-nitrophenyl)methylideneamino]-2-[[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-nitrosoamino]acetamide | 2 - N-[(Z)-(3-nitrophenyl)methylideneamino]-2-[[2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoethyl]-nitrosoamino]acetamide