| MolName | 1-(1-adamantyl)-3-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]thiourea |
| MolecularFormula | C25H29N3OS |
| Smiles | S=C(NC1(CC(C2)C3)CC3CC2C1)N/N=C\c1cc(OCc2ccccc2)ccc1 |
| InChI | InChI=1S/C25H29N3OS/c30-24(27-25-13-20-9-21(14-25)11-22(10-20)15-25)28-26-16-19-7-4-8-23(12-19)29-17-18-5-2-1-3-6-18/h1-8,12,16,20-22H,9-11,13-15,17H2,(H2,27,28,30) |
| InChIK | HYKDFLSUZPTTJJ-UHFFFAOYSA-N |
| TotalMolweight | 419.591 |
| Molweight | 419.591 |
| MonoisotopicMass | 419.203132 |
| CLogP | 5.3068 |
| CLogS | -6.49 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 327.14 |
| Relative PSA | 0.2214 |
| PolarSurfaceArea | 77.74 |
| Druglikeness | 2.6073 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 6 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 13 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - 1-(1-adamantyl)-3-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]thiourea | 2 - 1-(1-adamantyl)-3-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]thiourea