| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-(piperidin-1-ylmethyl)triazole-4-carboxamide |
| MolecularFormula | C29H28N9O3Cl |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc(cc2)Cl)c2OCc2cccc3ccccc23)=O)c1CN1CCCCC1 |
| InChI | InChI=1S/C29H28ClN9O3/c30-22-11-12-25(41-18-20-9-6-8-19-7-2-3-10-23(19)20)21(15-22)16-32-34-29(40)26-24(17-38-13-4-1-5-14-38)39(37-33-26)28-27(31)35-42-36-28/h2-3,6-12,15-16H,1,4-5,13-14,17-18H2,(H2,31,35)(H,34,40) |
| InChIK | HYRDCLDSZKFATM-UHFFFAOYSA-N |
| TotalMolweight | 586.054 |
| Molweight | 586.054 |
| MonoisotopicMass | 585.200363 |
| CLogP | 5.6538 |
| CLogS | -5.605 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 442.1 |
| Relative PSA | 0.29335 |
| PolarSurfaceArea | 149.58 |
| Druglikeness | 1.5558 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.47619 |
| Fragments | 1 |
| Non HAtoms | 42 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Sp3Atoms | 9 |
| Symmetricatoms | 2 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-(piperidin-1-ylmethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[5-chloro-2-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-(piperidin-1-ylmethyl)triazole-4-carboxamide