| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-phenylbenzamide |
| MolecularFormula | C20H14N2OCl2 |
| Smiles | O=C(c(cc1)ccc1-c1ccccc1)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C20H14Cl2N2O/c21-18-11-10-17(19(22)12-18)13-23-24-20(25)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-13H,(H,24,25) |
| InChIK | HZBPKXFLPRFWRC-UHFFFAOYSA-N |
| TotalMolweight | 369.25 |
| Molweight | 369.25 |
| MonoisotopicMass | 368.048317 |
| CLogP | 6.0728 |
| CLogS | -7.279 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 277.59 |
| Relative PSA | 0.12972 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 4.4715 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-phenylbenzamide | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-phenylbenzamide