| MolName | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C18H18N9O3F3 |
| Smiles | Nc1nonc1-n1nnc(CN2CCOCC2)c1C(N/N=C\c1ccc(C(F)(F)F)cc1)=O |
| InChI | InChI=1S/C18H18F3N9O3/c19-18(20,21)12-3-1-11(2-4-12)9-23-25-17(31)14-13(10-29-5-7-32-8-6-29)24-28-30(14)16-15(22)26-33-27-16/h1-4,9H,5-8,10H2,(H2,22,26)(H,25,31) |
| InChIK | HZDADEQHLRTYDE-UHFFFAOYSA-N |
| TotalMolweight | 465.395 |
| Molweight | 465.395 |
| MonoisotopicMass | 465.14847 |
| CLogP | 2.1896 |
| CLogS | -1.811 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 334.26 |
| Relative PSA | 0.38799 |
| PolarSurfaceArea | 149.58 |
| Druglikeness | -4.7729 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 8 |
| Symmetricatoms | 6 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]triazole-4-carboxamide | 2 - 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]triazole-4-carboxamide