| MolName | N'-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-naphthalen-1-yloxamide |
| MolecularFormula | C23H15N3O3Cl2 |
| Smiles | O=C(C(N/N=C/c1ccc(-c(cc2)cc(Cl)c2Cl)o1)=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C23H15Cl2N3O3/c24-18-10-8-15(12-19(18)25)21-11-9-16(31-21)13-26-28-23(30)22(29)27-20-7-3-5-14-4-1-2-6-17(14)20/h1-13H,(H,27,29)(H,28,30) |
| InChIK | HZRCOBZWYXBPLP-UHFFFAOYSA-N |
| TotalMolweight | 452.296 |
| Molweight | 452.296 |
| MonoisotopicMass | 451.049046 |
| CLogP | 5.4892 |
| CLogS | -8.063 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 331.09 |
| Relative PSA | 0.22538 |
| PolarSurfaceArea | 83.7 |
| Druglikeness | 5.6688 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-naphthalen-1-yloxamide | 2 - N'-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-naphthalen-1-yloxamide