| MolName | 2-amino-N-[2-(cyclohexen-1-yl)ethyl]-1-[(Z)-pyridin-2-ylmethylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide |
| MolecularFormula | C25H25N7O |
| Smiles | Nc1c(C(NCCC2=CCCCC2)=O)c2nc3ccccc3nc2n1/N=C\c1ncccc1 |
| InChI | InChI=1S/C25H25N7O/c26-23-21(25(33)28-15-13-17-8-2-1-3-9-17)22-24(31-20-12-5-4-11-19(20)30-22)32(23)29-16-18-10-6-7-14-27-18/h4-8,10-12,14,16H,1-3,9,13,15,26H2,(H,28,33) |
| InChIK | IAAWSXPXVKVPMR-UHFFFAOYSA-N |
| TotalMolweight | 439.522 |
| Molweight | 439.522 |
| MonoisotopicMass | 439.212058 |
| CLogP | 3.6071 |
| CLogS | -7.898 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 343.96 |
| Relative PSA | 0.26474 |
| PolarSurfaceArea | 111.08 |
| Druglikeness | 0.0040479 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 7 |
| Amides | 1 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-amino-N-[2-(cyclohexen-1-yl)ethyl]-1-[(Z)-pyridin-2-ylmethylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide | 2 - 2-amino-N-[2-(cyclohexen-1-yl)ethyl]-1-[(Z)-pyridin-2-ylmethylideneamino]pyrrolo[3,2-b]quinoxaline-3-carboxamide