| MolName | 2-chloro-N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-4-(trifluoromethyl)aniline |
| MolecularFormula | C21H18N4OClF3S |
| Smiles | FC(c(cc1)cc(Cl)c1N/N=C\c1c(-c2ccccc2)nc(N2CCOCC2)s1)(F)F |
| InChI | InChI=1S/C21H18ClF3N4OS/c22-16-12-15(21(23,24)25)6-7-17(16)28-26-13-18-19(14-4-2-1-3-5-14)27-20(31-18)29-8-10-30-11-9-29/h1-7,12-13,28H,8-11H2 |
| InChIK | IALRAQBSTUYHSJ-UHFFFAOYSA-N |
| TotalMolweight | 466.914 |
| Molweight | 466.914 |
| MonoisotopicMass | 466.084192 |
| CLogP | 7.4219 |
| CLogS | -6.387 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 330.42 |
| Relative PSA | 0.20534 |
| PolarSurfaceArea | 77.99 |
| Druglikeness | -2.54 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 6 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-chloro-N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-4-(trifluoromethyl)aniline | 2 - 2-chloro-N-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-4-(trifluoromethyl)aniline