| MolName | (Z)-N-(4-benzylpiperazin-4-ium-1-yl)-1-(2-chloro-5-nitrophenyl)methanimine |
| MolecularFormula | C18H20N4O2Cl |
| Smiles | [O-][N+](c(cc1)cc(/C=N\N2CC[NH+](Cc3ccccc3)CC2)c1Cl)=O |
| InChI | InChI=1S/C18H19ClN4O2/c19-18-7-6-17(23(24)25)12-16(18)13-20-22-10-8-21(9-11-22)14-15-4-2-1-3-5-15/h1-7,12-13H,8-11,14H2/p+1 |
| InChIK | IAMPZDSRGBVQSP-UHFFFAOYSA-O |
| TotalMolweight | 359.836 |
| Molweight | 359.836 |
| MonoisotopicMass | 359.127478 |
| CLogP | 1.9085 |
| CLogS | -3.852 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 286.81 |
| Relative PSA | 0.2199 |
| PolarSurfaceArea | 65.86 |
| Druglikeness | -1.0785 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-(4-benzylpiperazin-4-ium-1-yl)-1-(2-chloro-5-nitrophenyl)methanimine | 2 - (Z)-N-(4-benzylpiperazin-4-ium-1-yl)-1-(2-chloro-5-nitrophenyl)methanimine