| MolName | N-[(Z)-(4-bromophenyl)methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| MolecularFormula | C19H24N7OBr |
| Smiles | Brc1ccc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C19H24BrN7O/c20-16-6-4-15(5-7-16)14-21-25-17-22-18(26-8-2-1-3-9-26)24-19(23-17)27-10-12-28-13-11-27/h4-7,14H,1-3,8-13H2,(H,22,23,24,25) |
| InChIK | IANSOVONMSJSNR-UHFFFAOYSA-N |
| TotalMolweight | 446.352 |
| Molweight | 446.352 |
| MonoisotopicMass | 445.122569 |
| CLogP | 5.4897 |
| CLogS | -5.264 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 311.59 |
| Relative PSA | 0.23422 |
| PolarSurfaceArea | 78.77 |
| Druglikeness | -0.19976 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53571 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 10 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-bromophenyl)methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine | 2 - N-[(Z)-(4-bromophenyl)methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine