| MolName | N-[2-oxo-2-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| MolecularFormula | C16H15N3O4S |
| Smiles | O=C(CNC(c(cc1)cc2c1OCCO2)=O)N/N=C\c1cccs1 |
| InChI | InChI=1S/C16H15N3O4S/c20-15(19-18-9-12-2-1-7-24-12)10-17-16(21)11-3-4-13-14(8-11)23-6-5-22-13/h1-4,7-9H,5-6,10H2,(H,17,21)(H,19,20) |
| InChIK | IAOCNNYYXOSTJF-UHFFFAOYSA-N |
| TotalMolweight | 345.378 |
| Molweight | 345.378 |
| MonoisotopicMass | 345.078327 |
| CLogP | 2.1307 |
| CLogS | -3.68 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 259.92 |
| Relative PSA | 0.38808 |
| PolarSurfaceArea | 117.26 |
| Druglikeness | -0.25051 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-oxo-2-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide | 2 - N-[2-oxo-2-[(2Z)-2-(thiophen-2-ylmethylidene)hydrazinyl]ethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide