| MolName | [3-[(Z)-[[(2S)-2-hydroxy-2-phenylacetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| MolecularFormula | C20H16N2O5 |
| Smiles | O[C@H](C(N/N=C\c1cccc(OC(c2ccco2)=O)c1)=O)c1ccccc1 |
| InChI | InChI=1S/C20H16N2O5/c23-18(15-7-2-1-3-8-15)19(24)22-21-13-14-6-4-9-16(12-14)27-20(25)17-10-5-11-26-17/h1-13,18,23H,(H,22,24)/t18-/m0/s1 |
| InChIK | IAQPIFFLKUNVEF-SFHVURJKSA-N |
| TotalMolweight | 364.356 |
| Molweight | 364.356 |
| MonoisotopicMass | 364.105923 |
| CLogP | 2.7488 |
| CLogS | -4.29 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 283.04 |
| Relative PSA | 0.30476 |
| PolarSurfaceArea | 101.13 |
| Druglikeness | 5.1711 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| StereoCenters | 1 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - [3-[(Z)-[[(2S)-2-hydroxy-2-phenylacetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate | 2 - [3-[(Z)-[[(2S)-2-hydroxy-2-phenylacetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate