| MolName | 3-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| MolecularFormula | C22H25N5O3S |
| Smiles | O=C(C1(CCCCC1)NC1=O)N1/N=C\c1c(-c2ccccc2)nc(N2CCOCC2)s1 |
| InChI | InChI=1S/C22H25N5O3S/c28-19-22(9-5-2-6-10-22)25-20(29)27(19)23-15-17-18(16-7-3-1-4-8-16)24-21(31-17)26-11-13-30-14-12-26/h1,3-4,7-8,15H,2,5-6,9-14H2,(H,25,29) |
| InChIK | IAYJZMZWDYEQCC-UHFFFAOYSA-N |
| TotalMolweight | 439.539 |
| Molweight | 439.539 |
| MonoisotopicMass | 439.16781 |
| CLogP | 3.2775 |
| CLogS | -5.46 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 323.79 |
| Relative PSA | 0.30106 |
| PolarSurfaceArea | 115.37 |
| Druglikeness | 2.8197 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 11 |
| Symmetricatoms | 6 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione | 2 - 3-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione